Which is more acidic maleic or fumaric acid?
Maleic acid is able to lose ion and it results in the formation of intra-hydrogen bond. Whereas fumaric acid being a trans isomer has strong interaction with both the oxygen atoms of each carboxylic group. That is why, maleic acid is a stronger acid than fumaric acid.
What is the PKA of maleic acid?
Maleic acid
| Names | |
|---|---|
| Density | 1.59 g/cm³ |
| Melting point | 135 °C (275 °F; 408 K) (decomposes) |
| Solubility in water | 478.8 g/L at 20 C |
| Acidity (pKa) | pka1 = 1.9 pka2 = 6.07 |
What affects rate of Diels-Alder reaction?
This means that three factors influence the Diels- Alder reaction, namely, the electron density of the carbons taking part in the addition reaction, the frontier orbital energy levels of the reactants, and, the steric energy of the transition state and the end product.
What is the PH of fumaric acid?
2.03
pH of Organic Acids and Salts
| Formula | Name | 100 mM |
|---|---|---|
| C7H6O3 | salicylic acid | 2.02 |
| C4H4O4 | fumaric acid | 2.03 |
| C4H6O6 | DL-tartaric acid | 2.03 |
| C4H6O4 | methylmalonic acid | 2.05 |
Why is maleic acid more soluble than fumaric acid?
Maleic acid is the cis-isomer of butenedioic acid, whereas fumaric acid is the trans-isomer. Maleic acid is more soluble in water than fumaric acid. The melting point (135 °C) is also much lower than that of fumaric acid (287 °C).
What is the Iupac name of maleic acid?
cis-butenedioic acid
| IUPAC Name | (Z)-but-2-enedioic acid |
|---|---|
| Alternative Names | maleic acid cis-butenedioic acid |
| Molecular Formula | C4H4O4 |
| Molar Mass | 116.072 g/mol |
| InChI | InChI=1S/C4H4O4/c5-3(6)1-2-4(7)8/h1-2H,(H,5,6)(H,7,8)/b2-1- |
What is the pKa of phosphoric acid?
Chapter 27 Appendix C: Dissociation Constants and pK a Values for Acids at 25°C
| Name | Formula | pK a1 |
|---|---|---|
| Phosphoric acid | H 3PO 4 | 2.16 |
| Phosphorous acid | H 3PO 3 | 1.3* |
| Pyrophosphoric acid | H 4P 2O 7 | 0.91 |
| Resorcinol | C 6H 4(OH) 2 | 9.32 |
Which Dienes will react with ethene in a Diels-Alder reaction?
Since Diels-Alder reactions are highly stereospecific, ethene will only react with s-cis conformation dienes.
What enzyme class is Fumarase?
Enzyme
Fumarase/Classification
Does acyclopentadene react with oxygen?
CYCLOPENTADIENE is incompatible with strong oxidizing agents. Ignites on contact with oxygen (O2) and ozone (O3). Explodes on contact with fuming nitric acid or a mixture of sulfuric acid and nitrogen tetroxide. Reacts vigorously on contact with potassium hydroxide and other strong bases.
Is cyclopentadiene a cycloalkene?
Cyclopentadiene is a cycloalkadiene. Cyclopentadiene is a colorless liquid with an irritating, terpene-like odor. Bp: 42.5°C; Flash point: 77°F. Density: 0.805 g cm-3. Cyclopentadiene belongs to the class of organic compounds known as cycloalkenes.
What is 1 3 cyclopentadiene used for?
IDENTIFICATION AND USE: 1,3-Cyclopentadiene is a colorless liquid with an unpleasant odor. It is used as a starter compound in the manufacturing of resins and in organic synthesis as a starting material for synthetic prostaglandins, chlorinated insecticides, and formation of sandwich compounds by chelation.
Is cyclopentadiene harmful to humans?
RISK: 1,3-Cyclopentadiene is irritating to eyes and mucous membranes. In the eyes, it can cause redness and pain. Inhalation of large amounts can cause coughing and sore throat. In animal toxicity studies, mild injuries to the liver and kidneys were observed in rats breathing in vapors. Vapor concentrations were about 500 ppm.
