What is the use of pimelic acid?
Pimelic acid is an alpha,omega-dicarboxylic acid that is pentane with two carboxylic acid groups at positions C-1 and C-5. It has a role as an Escherichia coli metabolite and a Daphnia magna metabolite.
What is the source of pimelic acid?
Pimelic acid has been synthesized from cyclohexanone and from salicylic acid. In the former route, the additional carbon is supplied by dimethyloxalate, which reacts with the enolate.
Is pimelic acid soluble in water?
Properties
| Property | Value | Source |
|---|---|---|
| Water Solubility | 13.3 mg/mL | ALOGPS |
| logP | 0.51 | ALOGPS |
| logP | 0.94 | ChemAxon |
| logS | -1.1 | ALOGPS |
How many carbons are in Pimetic acid?
Showing Compound Pimelic acid (FDB022283)
| Record Information | |
|---|---|
| Description | Belongs to the class of organic compounds known as medium-chain fatty acids. These are fatty acids with an aliphatic tail that contains between 4 and 12 carbon atoms. |
| Kingdom | Organic compounds |
| Super Class | Lipids and lipid-like molecules |
| Class | Fatty Acyls |
Is salicylic acid a phenol?
Salicylic acid contains a phenol group, and phenols are known to be irritating. Aspirin can be made by reacting salicylic acid with acetic acid in the presence of an acid catalyst. The phenol group on the salicylic acid forms an ester with the carboxyl group on the acetic acid.
What is the action of heat on adipic acid?
When adipic acid is heated, there is loss of a water molecule and results in formation of adipic anhydride. When adipic acid is heated,cyclopentanone is obtained . It contains one carbon atom less than Adipic acid which indicates decarboxylation,also a molecule of water is lost which results is cyclization.
What is the structural formula of pimelic acid?
C7H12O4Pimelic acid / Formula
What is the Iupac name of pimelic acid?
heptanedioic acid
| IUPAC Name | heptanedioic acid |
|---|---|
| Alternative Names | pimelic acid Heptanedioic acid 1,5-Pentanedicarboxylic acid Heptandioic acid pimelate Heptane-1,7-dioic acid |
| Molecular Formula | C7H12O4 |
| Molar Mass | 160.169 g/mol |
| InChI | InChI=1S/C7H12O4/c8-6(9)4-2-1-3-5-7(10)11/h1-5H2,(H,8,9)(H,10,11) |
What happens when pimelic acid is heated?
When adipic acid is heated,cyclopentanone is obtained . It contains one carbon atom less than Adipic acid which indicates decarboxylation,also a molecule of water is lost which results is cyclization.
What is meant by pimelic acid?
Pimelic(adj) pertaining to, or designating, a substance obtained from certain fatty substances, and subsequently shown to be a mixture of suberic and adipic acids. Pimelic(adj) designating the acid proper (C5H10(CO2/H)2) which is obtained from camphoric acid.
How do adipic acid and pimelic acid pyrolyze?
Adipic acid (hexanedioic acid) and pimelic acid (heptanedioic acid) pyrolyze differently from the acids with a smaller number of carbon atoms. The typical reaction for these acids is the elimination of H2 O and CO 2 with the formation of a ketone by the following reaction:
How do you make pimelic acid from cyclohexanone?
Pimelic acid has been synthesized from cyclohexanone and from salicylic acid. In the former route, the additional carbon is supplied by dimethyloxalate, which reacts with the enolate.
